C25H22O4 — CID 150005395
ethyl 4-(2-hydroxyphenyl)-6-naphthalen-1-yl-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 150005395) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is ethyl 4-(2-hydroxyphenyl)-6-naphthalen-1-yl-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(2-hydroxyphenyl)-6-naphthalen-1-yl-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 150005395 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | ethyl 4-(2-hydroxyphenyl)-6-naphthalen-1-yl-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccccc2O)CC1c1cccc2ccccc12 |
| InChI | InChI=1S/C25H22O4/c1-2-29-25(28)24-21(20-12-7-9-16-8-3-4-10-18(16)20)14-17(15-23(24)27)19-11-5-6-13-22(19)26/h3-13,15,21,24,26H,2,14H2,1H3 |
| InChIKey | DCDXUGLOGZGENM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|