C24H26O4 — CID 99802055
ethyl (1S,6R)-6-(4-ethylphenyl)-4-(2-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 99802055) has the molecular formula C24H26O4 and a molecular weight of 378.47 g/mol. Its IUPAC name is ethyl (1S,6R)-6-(4-ethylphenyl)-4-(2-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6R)-6-(4-ethylphenyl)-4-(2-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 99802055 |
| Molecular Formula | C24H26O4 |
| Molecular Weight | 378.47 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | ethyl (1S,6R)-6-(4-ethylphenyl)-4-(2-methoxyphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C(c2ccccc2OC)C[C@H]1c1ccc(CC)cc1 |
| InChI | InChI=1S/C24H26O4/c1-4-16-10-12-17(13-11-16)20-14-18(19-8-6-7-9-22(19)27-3)15-21(25)23(20)24(26)28-5-2/h6-13,15,20,23H,4-5,14H2,1-3H3/t20-,23-/m0/s1 |
| InChIKey | FKNFFENXZNCHTK-REWPJTCUSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.47 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|