C21H22O3S — CID 99798640
ethyl (1R,6S)-6-(4-ethylphenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate (PubChem CID 99798640) has the molecular formula C21H22O3S and a molecular weight of 354.47 g/mol. Its IUPAC name is ethyl (1R,6S)-6-(4-ethylphenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6S)-6-(4-ethylphenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 99798640 |
| Molecular Formula | C21H22O3S |
| Molecular Weight | 354.47 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | ethyl (1R,6S)-6-(4-ethylphenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C(c2ccsc2)C[C@@H]1c1ccc(CC)cc1 |
| InChI | InChI=1S/C21H22O3S/c1-3-14-5-7-15(8-6-14)18-11-17(16-9-10-25-13-16)12-19(22)20(18)21(23)24-4-2/h5-10,12-13,18,20H,3-4,11H2,1-2H3/t18-,20-/m1/s1 |
| InChIKey | DGVOKXURWLCPSB-UYAOXDASSA-N |
| XLogP | 4.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|