C22H21ClO3 — CID 25362948
ethyl (1R,6R)-6-(4-chlorophenyl)-4-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 25362948) has the molecular formula C22H21ClO3 and a molecular weight of 368.86 g/mol. Its IUPAC name is ethyl (1R,6R)-6-(4-chlorophenyl)-4-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6R)-6-(4-chlorophenyl)-4-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 25362948 |
| Molecular Formula | C22H21ClO3 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | ethyl (1R,6R)-6-(4-chlorophenyl)-4-(4-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C(c2ccc(C)cc2)C[C@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H21ClO3/c1-3-26-22(25)21-19(16-8-10-18(23)11-9-16)12-17(13-20(21)24)15-6-4-14(2)5-7-15/h4-11,13,19,21H,3,12H2,1-2H3/t19-,21+/m0/s1 |
| InChIKey | ZGIZJVGAAUXZPS-PZJWPPBQSA-N |
| XLogP | 4.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|