C21H17ClI2O4 — CID 11678934
ethyl 6-(4-chlorophenyl)-4-(2-hydroxy-3,5-diiodophenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 11678934) has the molecular formula C21H17ClI2O4 and a molecular weight of 622.62 g/mol. Its IUPAC name is ethyl 6-(4-chlorophenyl)-4-(2-hydroxy-3,5-diiodophenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(4-chlorophenyl)-4-(2-hydroxy-3,5-diiodophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11678934 |
| Molecular Formula | C21H17ClI2O4 |
| Molecular Weight | 622.62 g/mol |
| Exact Mass | 621.89 |
| IUPAC Name | ethyl 6-(4-chlorophenyl)-4-(2-hydroxy-3,5-diiodophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2cc(I)cc(I)c2O)CC1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C21H17ClI2O4/c1-2-28-21(27)19-15(11-3-5-13(22)6-4-11)7-12(8-18(19)25)16-9-14(23)10-17(24)20(16)26/h3-6,8-10,15,19,26H,2,7H2,1H3 |
| InChIKey | IOVKJJNZKMJVAQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|