C28H26O3 — CID 11212031
ethyl 6-(3-methylphenyl)-2-oxo-4-(4-phenylphenyl)cyclohex-3-ene-1-carboxylate (PubChem CID 11212031) has the molecular formula C28H26O3 and a molecular weight of 410.51 g/mol. Its IUPAC name is ethyl 6-(3-methylphenyl)-2-oxo-4-(4-phenylphenyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(3-methylphenyl)-2-oxo-4-(4-phenylphenyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 11212031 |
| Molecular Formula | C28H26O3 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | ethyl 6-(3-methylphenyl)-2-oxo-4-(4-phenylphenyl)cyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccc(-c3ccccc3)cc2)CC1c1cccc(C)c1 |
| InChI | InChI=1S/C28H26O3/c1-3-31-28(30)27-25(23-11-7-8-19(2)16-23)17-24(18-26(27)29)22-14-12-21(13-15-22)20-9-5-4-6-10-20/h4-16,18,25,27H,3,17H2,1-2H3 |
| InChIKey | VUZUQHALWPKDBL-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|