C23H24O4 — CID 86820216
ethyl 6-(3-methoxyphenyl)-4-(3-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 86820216) has the molecular formula C23H24O4 and a molecular weight of 364.44 g/mol. Its IUPAC name is ethyl 6-(3-methoxyphenyl)-4-(3-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 6-(3-methoxyphenyl)-4-(3-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 86820216 |
| Molecular Formula | C23H24O4 |
| Molecular Weight | 364.44 g/mol |
| Exact Mass | 364.17 |
| IUPAC Name | ethyl 6-(3-methoxyphenyl)-4-(3-methylphenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2cccc(C)c2)CC1c1cccc(OC)c1 |
| InChI | InChI=1S/C23H24O4/c1-4-27-23(25)22-20(17-9-6-10-19(12-17)26-3)13-18(14-21(22)24)16-8-5-7-15(2)11-16/h5-12,14,20,22H,4,13H2,1-3H3 |
| InChIKey | IJGOEWYYVDPYCC-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.44 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|