C19H17FO3S — CID 99798552
ethyl (1S,6R)-6-(3-fluorophenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate (PubChem CID 99798552) has the molecular formula C19H17FO3S and a molecular weight of 344.41 g/mol. Its IUPAC name is ethyl (1S,6R)-6-(3-fluorophenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1S,6R)-6-(3-fluorophenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 99798552 |
| Molecular Formula | C19H17FO3S |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.09 |
| IUPAC Name | ethyl (1S,6R)-6-(3-fluorophenyl)-2-oxo-4-thiophen-3-ylcyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1C(=O)C=C(c2ccsc2)C[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C19H17FO3S/c1-2-23-19(22)18-16(12-4-3-5-15(20)8-12)9-14(10-17(18)21)13-6-7-24-11-13/h3-8,10-11,16,18H,2,9H2,1H3/t16-,18-/m0/s1 |
| InChIKey | RTOKJBUJALOTRM-WMZOPIPTSA-N |
| XLogP | 4.21 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|