C21H18FNO5 — CID 5173480
ethyl 4-(4-fluorophenyl)-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 5173480) has the molecular formula C21H18FNO5 and a molecular weight of 383.38 g/mol. Its IUPAC name is ethyl 4-(4-fluorophenyl)-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(4-fluorophenyl)-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 5173480 |
| Molecular Formula | C21H18FNO5 |
| Molecular Weight | 383.38 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | ethyl 4-(4-fluorophenyl)-6-(3-nitrophenyl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2ccc(F)cc2)CC1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C21H18FNO5/c1-2-28-21(25)20-18(14-4-3-5-17(10-14)23(26)27)11-15(12-19(20)24)13-6-8-16(22)9-7-13/h3-10,12,18,20H,2,11H2,1H3 |
| InChIKey | FKPIHMWYZYRBSX-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 86.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|