C19H17FO4 — CID 41098733
ethyl (1R,6R)-4-(4-fluorophenyl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 41098733) has the molecular formula C19H17FO4 and a molecular weight of 328.34 g/mol. Its IUPAC name is ethyl (1R,6R)-4-(4-fluorophenyl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl (1R,6R)-4-(4-fluorophenyl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 41098733 |
| Molecular Formula | C19H17FO4 |
| Molecular Weight | 328.34 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | ethyl (1R,6R)-4-(4-fluorophenyl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C(=O)C=C(c2ccc(F)cc2)C[C@H]1c1ccco1 |
| InChI | InChI=1S/C19H17FO4/c1-2-23-19(22)18-15(17-4-3-9-24-17)10-13(11-16(18)21)12-5-7-14(20)8-6-12/h3-9,11,15,18H,2,10H2,1H3/t15-,18+/m0/s1 |
| InChIKey | XNXIPYJNNJMEHL-MAUKXSAKSA-N |
| XLogP | 3.74 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|