C17H15BrO4S — CID 46237325
ethyl 4-(3-bromothiophen-2-yl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate (PubChem CID 46237325) has the molecular formula C17H15BrO4S and a molecular weight of 395.27 g/mol. Its IUPAC name is ethyl 4-(3-bromothiophen-2-yl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate.
| Compound Name | ethyl 4-(3-bromothiophen-2-yl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 46237325 |
| Molecular Formula | C17H15BrO4S |
| Molecular Weight | 395.27 g/mol |
| Exact Mass | 393.99 |
| IUPAC Name | ethyl 4-(3-bromothiophen-2-yl)-6-(furan-2-yl)-2-oxocyclohex-3-ene-1-carboxylate |
| SMILES | CCOC(=O)C1C(=O)C=C(c2sccc2Br)CC1c1ccco1 |
| InChI | InChI=1S/C17H15BrO4S/c1-2-21-17(20)15-11(14-4-3-6-22-14)8-10(9-13(15)19)16-12(18)5-7-23-16/h3-7,9,11,15H,2,8H2,1H3 |
| InChIKey | VIECUHPYITXXAS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.27 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|