C13H14ClNO2 — CID 142612409
methyl 4-(6-chloro-3-pyridinyl)cyclohex-3-ene-1-carboxylate (PubChem CID 142612409) has the molecular formula C13H14ClNO2 and a molecular weight of 251.71 g/mol. Its IUPAC name is methyl 4-(6-chloro-3-pyridinyl)cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-(6-chloro-3-pyridinyl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 142612409 |
| Molecular Formula | C13H14ClNO2 |
| Molecular Weight | 251.71 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | methyl 4-(6-chloro-3-pyridinyl)cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(c2ccc(Cl)nc2)CC1 |
| InChI | InChI=1S/C13H14ClNO2/c1-17-13(16)10-4-2-9(3-5-10)11-6-7-12(14)15-8-11/h2,6-8,10H,3-5H2,1H3 |
| InChIKey | KRHKFYBMKYMZER-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.71 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|