C21H25N3O3 — CID 176914511
methyl 4-[6-[1-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]cyclohex-3-ene-1-carboxylate (PubChem CID 176914511) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is methyl 4-[6-[1-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]cyclohex-3-ene-1-carboxylate.
| Compound Name | methyl 4-[6-[1-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 176914511 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | methyl 4-[6-[1-(oxan-2-yl)pyrazol-3-yl]-3-pyridinyl]cyclohex-3-ene-1-carboxylate |
| SMILES | COC(=O)C1CC=C(c2ccc(-c3ccn(C4CCCCO4)n3)nc2)CC1 |
| InChI | InChI=1S/C21H25N3O3/c1-26-21(25)16-7-5-15(6-8-16)17-9-10-18(22-14-17)19-11-12-24(23-19)20-4-2-3-13-27-20/h5,9-12,14,16,20H,2-4,6-8,13H2,1H3 |
| InChIKey | HTRDMZRWKYZZFJ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |