C10H11ClN2O4S — CID 62706978
methyl 1-[(6-chloro-3-pyridinyl)sulfonyl]azetidine-3-carboxylate (PubChem CID 62706978) has the molecular formula C10H11ClN2O4S and a molecular weight of 290.73 g/mol. Its IUPAC name is methyl 1-[(6-chloro-3-pyridinyl)sulfonyl]azetidine-3-carboxylate.
| Compound Name | methyl 1-[(6-chloro-3-pyridinyl)sulfonyl]azetidine-3-carboxylate |
|---|---|
| PubChem CID | 62706978 |
| Molecular Formula | C10H11ClN2O4S |
| Molecular Weight | 290.73 g/mol |
| Exact Mass | 290.01 |
| IUPAC Name | methyl 1-[(6-chloro-3-pyridinyl)sulfonyl]azetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(S(=O)(=O)c2ccc(Cl)nc2)C1 |
| InChI | InChI=1S/C10H11ClN2O4S/c1-17-10(14)7-5-13(6-7)18(15,16)8-2-3-9(11)12-4-8/h2-4,7H,5-6H2,1H3 |
| InChIKey | HLJPRKVPZGOUKX-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.73 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|