C9H13N3O4S — CID 166939431
methyl 1-(1-methylimidazol-4-yl)sulfonylazetidine-3-carboxylate (PubChem CID 166939431) has the molecular formula C9H13N3O4S and a molecular weight of 259.29 g/mol. Its IUPAC name is methyl 1-(1-methylimidazol-4-yl)sulfonylazetidine-3-carboxylate.
| Compound Name | methyl 1-(1-methylimidazol-4-yl)sulfonylazetidine-3-carboxylate |
|---|---|
| PubChem CID | 166939431 |
| Molecular Formula | C9H13N3O4S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.06 |
| IUPAC Name | methyl 1-(1-methylimidazol-4-yl)sulfonylazetidine-3-carboxylate |
| SMILES | COC(=O)C1CN(S(=O)(=O)c2cn(C)cn2)C1 |
| InChI | InChI=1S/C9H13N3O4S/c1-11-5-8(10-6-11)17(14,15)12-3-7(4-12)9(13)16-2/h5-7H,3-4H2,1-2H3 |
| InChIKey | FOTKHRNDRPRQCJ-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 81.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |