C16H28N4O6S — CID 140653777
tert-butyl N-[(3R,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]carbamate (PubChem CID 140653777) has the molecular formula C16H28N4O6S and a molecular weight of 404.49 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 140653777 |
| Molecular Formula | C16H28N4O6S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | tert-butyl N-[(3R,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]carbamate |
| SMILES | COC(OC)[C@@H]1CN(S(=O)(=O)c2cn(C)cn2)C[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O6S/c1-16(2,3)26-15(21)18-12-8-20(7-11(12)14(24-5)25-6)27(22,23)13-9-19(4)10-17-13/h9-12,14H,7-8H2,1-6H3,(H,18,21)/t11-,12+/m1/s1 |
| InChIKey | CWWSLCCDIKIZRL-NEPJUHHUSA-N |
| XLogP | 0.55 |
| TPSA | 111.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|