C11H22N2O3 — CID 167292263
tert-butyl N-[(3R,4S)-3-hydroxy-1-methylpiperidin-4-yl]carbamate (PubChem CID 167292263) has the molecular formula C11H22N2O3 and a molecular weight of 230.31 g/mol. Its IUPAC name is tert-butyl N-[(3R,4S)-3-hydroxy-1-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4S)-3-hydroxy-1-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 167292263 |
| Molecular Formula | C11H22N2O3 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.16 |
| IUPAC Name | tert-butyl N-[(3R,4S)-3-hydroxy-1-methylpiperidin-4-yl]carbamate |
| SMILES | CN1CC[C@H](NC(=O)OC(C)(C)C)[C@H](O)C1 |
| InChI | InChI=1S/C11H22N2O3/c1-11(2,3)16-10(15)12-8-5-6-13(4)7-9(8)14/h8-9,14H,5-7H2,1-4H3,(H,12,15)/t8-,9+/m0/s1 |
| InChIKey | MOOGVNUVXMMWTR-DTWKUNHWSA-N |
| XLogP | 0.58 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |