C10H19NO5S — CID 178017060
tert-butyl N-[(3S,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate (PubChem CID 178017060) has the molecular formula C10H19NO5S and a molecular weight of 265.33 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate |
|---|---|
| PubChem CID | 178017060 |
| Molecular Formula | C10H19NO5S |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | tert-butyl N-[(3S,4R)-3-hydroxy-1,1-dioxothian-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCS(=O)(=O)C[C@H]1O |
| InChI | InChI=1S/C10H19NO5S/c1-10(2,3)16-9(13)11-7-4-5-17(14,15)6-8(7)12/h7-8,12H,4-6H2,1-3H3,(H,11,13)/t7-,8-/m1/s1 |
| InChIKey | UVSJWPKERWLXIO-HTQZYQBOSA-N |
| XLogP | 0.06 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |