C10H20N2O4S — CID 90939247
tert-butyl N-[(3R,4R)-3-amino-1,1-dioxothian-4-yl]carbamate (PubChem CID 90939247) has the molecular formula C10H20N2O4S and a molecular weight of 264.35 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-3-amino-1,1-dioxothian-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-3-amino-1,1-dioxothian-4-yl]carbamate |
|---|---|
| PubChem CID | 90939247 |
| Molecular Formula | C10H20N2O4S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.11 |
| IUPAC Name | tert-butyl N-[(3R,4R)-3-amino-1,1-dioxothian-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCS(=O)(=O)C[C@@H]1N |
| InChI | InChI=1S/C10H20N2O4S/c1-10(2,3)16-9(13)12-8-4-5-17(14,15)6-7(8)11/h7-8H,4-6,11H2,1-3H3,(H,12,13)/t7-,8+/m0/s1 |
| InChIKey | POPSAHJDHHOFHE-JGVFFNPUSA-N |
| XLogP | 0.03 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |