C12H24N2O2 — CID 86650624
tert-butyl N-[(1S,2S,4S)-4-amino-2-methylcyclohexyl]carbamate (PubChem CID 86650624) has the molecular formula C12H24N2O2 and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,4S)-4-amino-2-methylcyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,4S)-4-amino-2-methylcyclohexyl]carbamate |
|---|---|
| PubChem CID | 86650624 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl N-[(1S,2S,4S)-4-amino-2-methylcyclohexyl]carbamate |
| SMILES | C[C@H]1C[C@@H](N)CC[C@@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-8-7-9(13)5-6-10(8)14-11(15)16-12(2,3)4/h8-10H,5-7,13H2,1-4H3,(H,14,15)/t8-,9-,10-/m0/s1 |
| InChIKey | PZNAUDPCCPSHBZ-GUBZILKMSA-N |
| XLogP | 2.03 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |