C10H17NO5S — CID 11807521
tert-butyl N-[(4S)-1,1,3-trioxothian-4-yl]carbamate (PubChem CID 11807521) has the molecular formula C10H17NO5S and a molecular weight of 263.31 g/mol. Its IUPAC name is tert-butyl N-[(4S)-1,1,3-trioxothian-4-yl]carbamate.
| Compound Name | tert-butyl N-[(4S)-1,1,3-trioxothian-4-yl]carbamate |
|---|---|
| PubChem CID | 11807521 |
| Molecular Formula | C10H17NO5S |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | tert-butyl N-[(4S)-1,1,3-trioxothian-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CCS(=O)(=O)CC1=O |
| InChI | InChI=1S/C10H17NO5S/c1-10(2,3)16-9(13)11-7-4-5-17(14,15)6-8(7)12/h7H,4-6H2,1-3H3,(H,11,13)/t7-/m0/s1 |
| InChIKey | RJQRXKCRDWVGBQ-ZETCQYMHSA-N |
| XLogP | 0.27 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |