C16H28N4O5S — CID 90450852
tert-butyl N-[(3S,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfinylpyrrolidin-3-yl]carbamate (PubChem CID 90450852) has the molecular formula C16H28N4O5S and a molecular weight of 388.49 g/mol. Its IUPAC name is tert-butyl N-[(3S,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfinylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfinylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 90450852 |
| Molecular Formula | C16H28N4O5S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.18 |
| IUPAC Name | tert-butyl N-[(3S,4R)-4-(dimethoxymethyl)-1-(1-methylimidazol-4-yl)sulfinylpyrrolidin-3-yl]carbamate |
| SMILES | COC(OC)[C@@H]1CN(S(=O)c2cn(C)cn2)C[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H28N4O5S/c1-16(2,3)25-15(21)18-12-8-20(7-11(12)14(23-5)24-6)26(22)13-9-19(4)10-17-13/h9-12,14H,7-8H2,1-6H3,(H,18,21)/t11-,12-,26?/m1/s1 |
| InChIKey | TXIDURDVMGXHFA-RRUHVXSYSA-N |
| XLogP | 0.89 |
| TPSA | 94.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|