C15H21ClIN3O3 — CID 172626872
tert-butyl N-[(3R,4R)-1-(2-chloro-5-iodo-4-pyridinyl)-3-hydroxypiperidin-4-yl]carbamate (PubChem CID 172626872) has the molecular formula C15H21ClIN3O3 and a molecular weight of 453.71 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-(2-chloro-5-iodo-4-pyridinyl)-3-hydroxypiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-(2-chloro-5-iodo-4-pyridinyl)-3-hydroxypiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 172626872 |
| Molecular Formula | C15H21ClIN3O3 |
| Molecular Weight | 453.71 g/mol |
| Exact Mass | 453.03 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-(2-chloro-5-iodo-4-pyridinyl)-3-hydroxypiperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2cc(Cl)ncc2I)C[C@H]1O |
| InChI | InChI=1S/C15H21ClIN3O3/c1-15(2,3)23-14(22)19-10-4-5-20(8-12(10)21)11-6-13(16)18-7-9(11)17/h6-7,10,12,21H,4-5,8H2,1-3H3,(H,19,22)/t10-,12-/m1/s1 |
| InChIKey | HRROFZKBBHHMDY-ZYHUDNBSSA-N |
| XLogP | 2.80 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.71 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|