C20H26ClF2N5O2 — CID 172626714
tert-butyl N-[(3R,4R)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-4-yl]carbamate (PubChem CID 172626714) has the molecular formula C20H26ClF2N5O2 and a molecular weight of 441.91 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 172626714 |
| Molecular Formula | C20H26ClF2N5O2 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-4-yl]carbamate |
| SMILES | C[C@@H]1CN(c2cc(Cl)ncc2-c2cnn(C(F)F)c2)CC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H26ClF2N5O2/c1-12-10-27(6-5-15(12)26-19(29)30-20(2,3)4)16-7-17(21)24-9-14(16)13-8-25-28(11-13)18(22)23/h7-9,11-12,15,18H,5-6,10H2,1-4H3,(H,26,29)/t12-,15-/m1/s1 |
| InChIKey | RRDPPEQOILEQFD-IUODEOHRSA-N |
| XLogP | 4.73 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|