C20H26ClF2N5O2 — CID 172626580
tert-butyl N-[(3S)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-3-yl]carbamate (PubChem CID 172626580) has the molecular formula C20H26ClF2N5O2 and a molecular weight of 441.91 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 172626580 |
| Molecular Formula | C20H26ClF2N5O2 |
| Molecular Weight | 441.91 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-chloro-5-[1-(difluoromethyl)pyrazol-4-yl]-4-pyridinyl]-3-methylpiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C)CCCN(c2cc(Cl)ncc2-c2cnn(C(F)F)c2)C1 |
| InChI | InChI=1S/C20H26ClF2N5O2/c1-19(2,3)30-18(29)26-20(4)6-5-7-27(12-20)15-8-16(21)24-10-14(15)13-9-25-28(11-13)17(22)23/h8-11,17H,5-7,12H2,1-4H3,(H,26,29)/t20-/m0/s1 |
| InChIKey | DYMQPYRCQLFALK-FQEVSTJZSA-N |
| XLogP | 4.88 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.91 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|