C23H24F2N4O3 — CID 156623594
tert-butyl N-[(3S)-1-[2-cyano-3-(3,5-difluorophenyl)-5-formyl-4-pyridinyl]-3-methylpyrrolidin-3-yl]carbamate (PubChem CID 156623594) has the molecular formula C23H24F2N4O3 and a molecular weight of 442.47 g/mol. Its IUPAC name is tert-butyl N-[(3S)-1-[2-cyano-3-(3,5-difluorophenyl)-5-formyl-4-pyridinyl]-3-methylpyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-1-[2-cyano-3-(3,5-difluorophenyl)-5-formyl-4-pyridinyl]-3-methylpyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 156623594 |
| Molecular Formula | C23H24F2N4O3 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.18 |
| IUPAC Name | tert-butyl N-[(3S)-1-[2-cyano-3-(3,5-difluorophenyl)-5-formyl-4-pyridinyl]-3-methylpyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@]1(C)CCN(c2c(C=O)cnc(C#N)c2-c2cc(F)cc(F)c2)C1 |
| InChI | InChI=1S/C23H24F2N4O3/c1-22(2,3)32-21(31)28-23(4)5-6-29(13-23)20-15(12-30)11-27-18(10-26)19(20)14-7-16(24)9-17(25)8-14/h7-9,11-12H,5-6,13H2,1-4H3,(H,28,31)/t23-/m0/s1 |
| InChIKey | AUTDSLTUKBKTFF-QHCPKHFHSA-N |
| XLogP | 4.20 |
| TPSA | 95.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|