C22H30ClN3O4 — CID 176977220
tert-butyl N-[(3R,4R)-1-[2-chloro-5-[2-(oxan-4-yl)ethynyl]-4-pyridinyl]-4-hydroxypiperidin-3-yl]carbamate (PubChem CID 176977220) has the molecular formula C22H30ClN3O4 and a molecular weight of 435.95 g/mol. Its IUPAC name is tert-butyl N-[(3R,4R)-1-[2-chloro-5-[2-(oxan-4-yl)ethynyl]-4-pyridinyl]-4-hydroxypiperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R,4R)-1-[2-chloro-5-[2-(oxan-4-yl)ethynyl]-4-pyridinyl]-4-hydroxypiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 176977220 |
| Molecular Formula | C22H30ClN3O4 |
| Molecular Weight | 435.95 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | tert-butyl N-[(3R,4R)-1-[2-chloro-5-[2-(oxan-4-yl)ethynyl]-4-pyridinyl]-4-hydroxypiperidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CN(c2cc(Cl)ncc2C#CC2CCOCC2)CC[C@H]1O |
| InChI | InChI=1S/C22H30ClN3O4/c1-22(2,3)30-21(28)25-17-14-26(9-6-19(17)27)18-12-20(23)24-13-16(18)5-4-15-7-10-29-11-8-15/h12-13,15,17,19,27H,6-11,14H2,1-3H3,(H,25,28)/t17-,19-/m1/s1 |
| InChIKey | VQODEXSAYAVPKI-IEBWSBKVSA-N |
| XLogP | 2.98 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.95 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|