C13H18ClIN2O — CID 167426940
2-[1-(2-chloro-5-iodo-4-pyridinyl)piperidin-4-yl]propan-2-ol (PubChem CID 167426940) has the molecular formula C13H18ClIN2O and a molecular weight of 380.66 g/mol. Its IUPAC name is 2-[1-(2-chloro-5-iodo-4-pyridinyl)piperidin-4-yl]propan-2-ol.
| Compound Name | 2-[1-(2-chloro-5-iodo-4-pyridinyl)piperidin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 167426940 |
| Molecular Formula | C13H18ClIN2O |
| Molecular Weight | 380.66 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 2-[1-(2-chloro-5-iodo-4-pyridinyl)piperidin-4-yl]propan-2-ol |
| SMILES | CC(C)(O)C1CCN(c2cc(Cl)ncc2I)CC1 |
| InChI | InChI=1S/C13H18ClIN2O/c1-13(2,18)9-3-5-17(6-4-9)11-7-12(14)16-8-10(11)15/h7-9,18H,3-6H2,1-2H3 |
| InChIKey | XCFLHSWBARHAHH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.66 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|