C12H13ClF3IN2 — CID 172626664
2-chloro-5-iodo-4-[3-(2,2,2-trifluoroethyl)piperidin-1-yl]pyridine (PubChem CID 172626664) has the molecular formula C12H13ClF3IN2 and a molecular weight of 404.60 g/mol. Its IUPAC name is 2-chloro-5-iodo-4-[3-(2,2,2-trifluoroethyl)piperidin-1-yl]pyridine.
| Compound Name | 2-chloro-5-iodo-4-[3-(2,2,2-trifluoroethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 172626664 |
| Molecular Formula | C12H13ClF3IN2 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 403.98 |
| IUPAC Name | 2-chloro-5-iodo-4-[3-(2,2,2-trifluoroethyl)piperidin-1-yl]pyridine |
| SMILES | FC(F)(F)CC1CCCN(c2cc(Cl)ncc2I)C1 |
| InChI | InChI=1S/C12H13ClF3IN2/c13-11-4-10(9(17)6-18-11)19-3-1-2-8(7-19)5-12(14,15)16/h4,6,8H,1-3,5,7H2 |
| InChIKey | OIZKEXLZMOPIFT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|