C13H16ClF3N2O — CID 106588148
2-chloro-6-[3-(methoxymethyl)piperidin-1-yl]-4-(trifluoromethyl)pyridine (PubChem CID 106588148) has the molecular formula C13H16ClF3N2O and a molecular weight of 308.73 g/mol. Its IUPAC name is 2-chloro-6-[3-(methoxymethyl)piperidin-1-yl]-4-(trifluoromethyl)pyridine.
| Compound Name | 2-chloro-6-[3-(methoxymethyl)piperidin-1-yl]-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 106588148 |
| Molecular Formula | C13H16ClF3N2O |
| Molecular Weight | 308.73 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-chloro-6-[3-(methoxymethyl)piperidin-1-yl]-4-(trifluoromethyl)pyridine |
| SMILES | COCC1CCCN(c2cc(C(F)(F)F)cc(Cl)n2)C1 |
| InChI | InChI=1S/C13H16ClF3N2O/c1-20-8-9-3-2-4-19(7-9)12-6-10(13(15,16)17)5-11(14)18-12/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | UVRAELYBELEAPW-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.73 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|