C23H22ClF8N5 — CID 160739521
2-chloro-5-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine;5-fluoro-2-isocyano-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine (PubChem CID 160739521) has the molecular formula C23H22ClF8N5 and a molecular weight of 555.90 g/mol. Its IUPAC name is 2-chloro-5-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine;5-fluoro-2-isocyano-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine.
| Compound Name | 2-chloro-5-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine;5-fluoro-2-isocyano-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 160739521 |
| Molecular Formula | C23H22ClF8N5 |
| Molecular Weight | 555.90 g/mol |
| Exact Mass | 555.14 |
| IUPAC Name | 2-chloro-5-fluoro-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine;5-fluoro-2-isocyano-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
| SMILES | Fc1cnc(Cl)cc1N1CCC(C(F)(F)F)CC1.[C-]#[N+]c1cc(N2CCC(C(F)(F)F)CC2)c(F)cn1 |
| InChI | InChI=1S/C12H11F4N3.C11H11ClF4N2/c1-17-11-6-10(9(13)7-18-11)19-4-2-8(3-5-19)12(14,15)16;12-10-5-9(8(13)6-17-10)18-3-1-7(2-4-18)11(14,15)16/h6-8H,2-5H2;5-7H,1-4H2 |
| InChIKey | RVJUBGMGKBVXKR-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 36.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.90 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|