C12H14F4N2 — CID 118008416
5-fluoro-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine (PubChem CID 118008416) has the molecular formula C12H14F4N2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 5-fluoro-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine.
| Compound Name | 5-fluoro-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
|---|---|
| PubChem CID | 118008416 |
| Molecular Formula | C12H14F4N2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-fluoro-2-methyl-4-[4-(trifluoromethyl)piperidin-1-yl]pyridine |
| SMILES | Cc1cc(N2CCC(C(F)(F)F)CC2)c(F)cn1 |
| InChI | InChI=1S/C12H14F4N2/c1-8-6-11(10(13)7-17-8)18-4-2-9(3-5-18)12(14,15)16/h6-7,9H,2-5H2,1H3 |
| InChIKey | QZWLLVOODZPXJH-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |