C14H19F3N2 — CID 166062363
2,5-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline (PubChem CID 166062363) has the molecular formula C14H19F3N2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 2,5-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline.
| Compound Name | 2,5-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 166062363 |
| Molecular Formula | C14H19F3N2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 2,5-dimethyl-4-[4-(trifluoromethyl)piperidin-1-yl]aniline |
| SMILES | Cc1cc(N2CCC(C(F)(F)F)CC2)c(C)cc1N |
| InChI | InChI=1S/C14H19F3N2/c1-9-8-13(10(2)7-12(9)18)19-5-3-11(4-6-19)14(15,16)17/h7-8,11H,3-6,18H2,1-2H3 |
| InChIKey | FIRBUKMVUYIKNF-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|