C14H22BrN3 — CID 114048172
1-(4-amino-2-bromo-5-methylphenyl)-N,N-dimethylpiperidin-4-amine (PubChem CID 114048172) has the molecular formula C14H22BrN3 and a molecular weight of 312.26 g/mol. Its IUPAC name is 1-(4-amino-2-bromo-5-methylphenyl)-N,N-dimethylpiperidin-4-amine.
| Compound Name | 1-(4-amino-2-bromo-5-methylphenyl)-N,N-dimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 114048172 |
| Molecular Formula | C14H22BrN3 |
| Molecular Weight | 312.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 1-(4-amino-2-bromo-5-methylphenyl)-N,N-dimethylpiperidin-4-amine |
| SMILES | Cc1cc(N2CCC(N(C)C)CC2)c(Br)cc1N |
| InChI | InChI=1S/C14H22BrN3/c1-10-8-14(12(15)9-13(10)16)18-6-4-11(5-7-18)17(2)3/h8-9,11H,4-7,16H2,1-3H3 |
| InChIKey | YTEIQYVIVQLNHQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|