C9H8ClFN2O2 — CID 163368011
1-(2-chloro-5-fluoro-4-pyridinyl)azetidine-3-carboxylic acid (PubChem CID 163368011) has the molecular formula C9H8ClFN2O2 and a molecular weight of 230.63 g/mol. Its IUPAC name is 1-(2-chloro-5-fluoro-4-pyridinyl)azetidine-3-carboxylic acid.
| Compound Name | 1-(2-chloro-5-fluoro-4-pyridinyl)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 163368011 |
| Molecular Formula | C9H8ClFN2O2 |
| Molecular Weight | 230.63 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-(2-chloro-5-fluoro-4-pyridinyl)azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1CN(c2cc(Cl)ncc2F)C1 |
| InChI | InChI=1S/C9H8ClFN2O2/c10-8-1-7(6(11)2-12-8)13-3-5(4-13)9(14)15/h1-2,5H,3-4H2,(H,14,15) |
| InChIKey | JMKQCECWXHJOCZ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 53.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.63 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|