C11H9ClN2O5 — CID 168691533
5-(4-carboxy-2-oxopyrrolidin-1-yl)-2-chloropyridine-4-carboxylic acid (PubChem CID 168691533) has the molecular formula C11H9ClN2O5 and a molecular weight of 284.65 g/mol. Its IUPAC name is 5-(4-carboxy-2-oxopyrrolidin-1-yl)-2-chloropyridine-4-carboxylic acid.
| Compound Name | 5-(4-carboxy-2-oxopyrrolidin-1-yl)-2-chloropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 168691533 |
| Molecular Formula | C11H9ClN2O5 |
| Molecular Weight | 284.65 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 5-(4-carboxy-2-oxopyrrolidin-1-yl)-2-chloropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(Cl)ncc1N1CC(C(=O)O)CC1=O |
| InChI | InChI=1S/C11H9ClN2O5/c12-8-2-6(11(18)19)7(3-13-8)14-4-5(10(16)17)1-9(14)15/h2-3,5H,1,4H2,(H,16,17)(H,18,19) |
| InChIKey | HEFKHMKUJCLUFK-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.65 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|