C11H10ClNO3S — CID 168691682
1-(5-chloro-2-sulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid (PubChem CID 168691682) has the molecular formula C11H10ClNO3S and a molecular weight of 271.72 g/mol. Its IUPAC name is 1-(5-chloro-2-sulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid.
| Compound Name | 1-(5-chloro-2-sulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 168691682 |
| Molecular Formula | C11H10ClNO3S |
| Molecular Weight | 271.72 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | 1-(5-chloro-2-sulfanylphenyl)-5-oxopyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1CC(=O)N(c2cc(Cl)ccc2S)C1 |
| InChI | InChI=1S/C11H10ClNO3S/c12-7-1-2-9(17)8(4-7)13-5-6(11(15)16)3-10(13)14/h1-2,4,6,17H,3,5H2,(H,15,16) |
| InChIKey | RNVTYPAMWNSQOJ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.72 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|