C13H16ClF2IN2O — CID 172626660
[1-(2-chloro-5-iodo-4-pyridinyl)-4-(2,2-difluoroethyl)piperidin-4-yl]methanol (PubChem CID 172626660) has the molecular formula C13H16ClF2IN2O and a molecular weight of 416.64 g/mol. Its IUPAC name is [1-(2-chloro-5-iodo-4-pyridinyl)-4-(2,2-difluoroethyl)piperidin-4-yl]methanol.
| Compound Name | [1-(2-chloro-5-iodo-4-pyridinyl)-4-(2,2-difluoroethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 172626660 |
| Molecular Formula | C13H16ClF2IN2O |
| Molecular Weight | 416.64 g/mol |
| Exact Mass | 416.00 |
| IUPAC Name | [1-(2-chloro-5-iodo-4-pyridinyl)-4-(2,2-difluoroethyl)piperidin-4-yl]methanol |
| SMILES | OCC1(CC(F)F)CCN(c2cc(Cl)ncc2I)CC1 |
| InChI | InChI=1S/C13H16ClF2IN2O/c14-11-5-10(9(17)7-18-11)19-3-1-13(8-20,2-4-19)6-12(15)16/h5,7,12,20H,1-4,6,8H2 |
| InChIKey | NKTYDHPOQZCBOE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|