C12H14ClFIN3O2 — CID 87133359
4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]-4-fluoropiperidine-1-carboxylic acid (PubChem CID 87133359) has the molecular formula C12H14ClFIN3O2 and a molecular weight of 413.62 g/mol. Its IUPAC name is 4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]-4-fluoropiperidine-1-carboxylic acid.
| Compound Name | 4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]-4-fluoropiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 87133359 |
| Molecular Formula | C12H14ClFIN3O2 |
| Molecular Weight | 413.62 g/mol |
| Exact Mass | 412.98 |
| IUPAC Name | 4-[[(2-chloro-5-iodo-4-pyridinyl)amino]methyl]-4-fluoropiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CCC(F)(CNc2cc(Cl)ncc2I)CC1 |
| InChI | InChI=1S/C12H14ClFIN3O2/c13-10-5-9(8(15)6-16-10)17-7-12(14)1-3-18(4-2-12)11(19)20/h5-6H,1-4,7H2,(H,16,17)(H,19,20) |
| InChIKey | BHIQULPQDPXXLN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.62 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|