C22H27ClFN5O2 — CID 167427072
tert-butyl N-[[1-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-4-fluoropiperidin-4-yl]methyl]carbamate (PubChem CID 167427072) has the molecular formula C22H27ClFN5O2 and a molecular weight of 447.94 g/mol. Its IUPAC name is tert-butyl N-[[1-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-4-fluoropiperidin-4-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[1-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-4-fluoropiperidin-4-yl]methyl]carbamate |
|---|---|
| PubChem CID | 167427072 |
| Molecular Formula | C22H27ClFN5O2 |
| Molecular Weight | 447.94 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | tert-butyl N-[[1-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-4-fluoropiperidin-4-yl]methyl]carbamate |
| SMILES | Cn1cc(C#Cc2cnc(Cl)cc2N2CCC(F)(CNC(=O)OC(C)(C)C)CC2)cn1 |
| InChI | InChI=1S/C22H27ClFN5O2/c1-21(2,3)31-20(30)26-15-22(24)7-9-29(10-8-22)18-11-19(23)25-13-17(18)6-5-16-12-27-28(4)14-16/h11-14H,7-10,15H2,1-4H3,(H,26,30) |
| InChIKey | DQWNQRRFBGFBRV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.94 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|