C19H21ClF3N5O — CID 167426982
1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-4-[(dimethylamino)methyl]piperidin-4-ol (PubChem CID 167426982) has the molecular formula C19H21ClF3N5O and a molecular weight of 427.86 g/mol. Its IUPAC name is 1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-4-[(dimethylamino)methyl]piperidin-4-ol.
| Compound Name | 1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-4-[(dimethylamino)methyl]piperidin-4-ol |
|---|---|
| PubChem CID | 167426982 |
| Molecular Formula | C19H21ClF3N5O |
| Molecular Weight | 427.86 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | 1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-4-[(dimethylamino)methyl]piperidin-4-ol |
| SMILES | CN(C)CC1(O)CCN(c2cc(Cl)ncc2C#Cc2cnn(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C19H21ClF3N5O/c1-26(2)13-18(29)5-7-27(8-6-18)16-9-17(20)24-11-15(16)4-3-14-10-25-28(12-14)19(21,22)23/h9-12,29H,5-8,13H2,1-2H3 |
| InChIKey | YMJJXTSGYKZOCV-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.86 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|