C18H16ClF3N4O — CID 167426858
1-[1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]piperidin-4-yl]ethanone (PubChem CID 167426858) has the molecular formula C18H16ClF3N4O and a molecular weight of 396.80 g/mol. Its IUPAC name is 1-[1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]piperidin-4-yl]ethanone.
| Compound Name | 1-[1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]piperidin-4-yl]ethanone |
|---|---|
| PubChem CID | 167426858 |
| Molecular Formula | C18H16ClF3N4O |
| Molecular Weight | 396.80 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 1-[1-[2-chloro-5-[2-[1-(trifluoromethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]piperidin-4-yl]ethanone |
| SMILES | CC(=O)C1CCN(c2cc(Cl)ncc2C#Cc2cnn(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C18H16ClF3N4O/c1-12(27)14-4-6-25(7-5-14)16-8-17(19)23-10-15(16)3-2-13-9-24-26(11-13)18(20,21)22/h8-11,14H,4-7H2,1H3 |
| InChIKey | QYXCZEPVHRNRRT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.80 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|