C17H19ClN4O — CID 167427193
cis-(1R,3S)-3-[[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]amino]cyclohexan-1-ol (PubChem CID 167427193) has the molecular formula C17H19ClN4O and a molecular weight of 330.82 g/mol. Its IUPAC name is cis-(1R,3S)-3-[[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]amino]cyclohexan-1-ol.
| Compound Name | cis-(1R,3S)-3-[[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 167427193 |
| Molecular Formula | C17H19ClN4O |
| Molecular Weight | 330.82 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | cis-(1R,3S)-3-[[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]amino]cyclohexan-1-ol |
| SMILES | Cn1cc(C#Cc2cnc(Cl)cc2N[C@H]2CCC[C@@H](O)C2)cn1 |
| InChI | InChI=1S/C17H19ClN4O/c1-22-11-12(9-20-22)5-6-13-10-19-17(18)8-16(13)21-14-3-2-4-15(23)7-14/h8-11,14-15,23H,2-4,7H2,1H3,(H,19,21)/t14-,15+/m0/s1 |
| InChIKey | UFTMIFFZMKJDBF-LSDHHAIUSA-N |
| XLogP | 2.58 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|