C19H23ClFN5 — CID 171572620
4-N-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine (PubChem CID 171572620) has the molecular formula C19H23ClFN5 and a molecular weight of 375.88 g/mol. Its IUPAC name is 4-N-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine.
| Compound Name | 4-N-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 171572620 |
| Molecular Formula | C19H23ClFN5 |
| Molecular Weight | 375.88 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 4-N-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-1-N-(2-fluoroethyl)cyclohexane-1,4-diamine |
| SMILES | Cn1cc(C#Cc2cnc(Cl)cc2NC2CCC(NCCF)CC2)cn1 |
| InChI | InChI=1S/C19H23ClFN5/c1-26-13-14(11-24-26)2-3-15-12-23-19(20)10-18(15)25-17-6-4-16(5-7-17)22-9-8-21/h10-13,16-17,22H,4-9H2,1H3,(H,23,25) |
| InChIKey | AECDWWOSISMBGW-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.88 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|