C16H18ClFN4 — CID 167426571
N-butan-2-yl-2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]pyridin-4-amine (PubChem CID 167426571) has the molecular formula C16H18ClFN4 and a molecular weight of 320.80 g/mol. Its IUPAC name is N-butan-2-yl-2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]pyridin-4-amine.
| Compound Name | N-butan-2-yl-2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]pyridin-4-amine |
|---|---|
| PubChem CID | 167426571 |
| Molecular Formula | C16H18ClFN4 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | N-butan-2-yl-2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]pyridin-4-amine |
| SMILES | CCC(C)Nc1cc(Cl)ncc1C#Cc1cnn(CCF)c1 |
| InChI | InChI=1S/C16H18ClFN4/c1-3-12(2)21-15-8-16(17)19-10-14(15)5-4-13-9-20-22(11-13)7-6-18/h8-12H,3,6-7H2,1-2H3,(H,19,21) |
| InChIKey | XECJQJFGOZVDAR-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|