C21H26ClN5 — CID 167426882
3-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane (PubChem CID 167426882) has the molecular formula C21H26ClN5 and a molecular weight of 383.93 g/mol. Its IUPAC name is 3-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 167426882 |
| Molecular Formula | C21H26ClN5 |
| Molecular Weight | 383.93 g/mol |
| Exact Mass | 383.19 |
| IUPAC Name | 3-[2-chloro-5-[2-(1-methylpyrazol-4-yl)ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CN1CCC2(CC1)CCN(c1cc(Cl)ncc1C#Cc1cnn(C)c1)CC2 |
| InChI | InChI=1S/C21H26ClN5/c1-25-9-5-21(6-10-25)7-11-27(12-8-21)19-13-20(22)23-15-18(19)4-3-17-14-24-26(2)16-17/h13-16H,5-12H2,1-2H3 |
| InChIKey | RAIJTEYXOQPUEH-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|