C24H30ClN5 — CID 167427118
3-[2-chloro-5-[2-[1-(cyclopropylmethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane (PubChem CID 167427118) has the molecular formula C24H30ClN5 and a molecular weight of 423.99 g/mol. Its IUPAC name is 3-[2-chloro-5-[2-[1-(cyclopropylmethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3-[2-chloro-5-[2-[1-(cyclopropylmethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 167427118 |
| Molecular Formula | C24H30ClN5 |
| Molecular Weight | 423.99 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-[2-chloro-5-[2-[1-(cyclopropylmethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]-9-methyl-3,9-diazaspiro[5.5]undecane |
| SMILES | CN1CCC2(CC1)CCN(c1cc(Cl)ncc1C#Cc1cnn(CC3CC3)c1)CC2 |
| InChI | InChI=1S/C24H30ClN5/c1-28-10-6-24(7-11-28)8-12-29(13-9-24)22-14-23(25)26-16-21(22)5-4-20-15-27-30(18-20)17-19-2-3-19/h14-16,18-19H,2-3,6-13,17H2,1H3 |
| InChIKey | MTJSAHBIYNKGGP-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.99 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|