C20H24ClFN4O — CID 167427307
[4-[[[2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]amino]methyl]cyclohexyl]methanol (PubChem CID 167427307) has the molecular formula C20H24ClFN4O and a molecular weight of 390.89 g/mol. Its IUPAC name is [4-[[[2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]amino]methyl]cyclohexyl]methanol.
| Compound Name | [4-[[[2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]amino]methyl]cyclohexyl]methanol |
|---|---|
| PubChem CID | 167427307 |
| Molecular Formula | C20H24ClFN4O |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | [4-[[[2-chloro-5-[2-[1-(2-fluoroethyl)pyrazol-4-yl]ethynyl]-4-pyridinyl]amino]methyl]cyclohexyl]methanol |
| SMILES | OCC1CCC(CNc2cc(Cl)ncc2C#Cc2cnn(CCF)c2)CC1 |
| InChI | InChI=1S/C20H24ClFN4O/c21-20-9-19(23-10-15-1-3-16(14-27)4-2-15)18(12-24-20)6-5-17-11-25-26(13-17)8-7-22/h9,11-13,15-16,27H,1-4,7-8,10,14H2,(H,23,24) |
| InChIKey | JJEPVPZHGMTACE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|