C18H23ClN2O — CID 175857987
[4-[[2-chloro-5-[2-(1-methylcyclopropyl)ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol (PubChem CID 175857987) has the molecular formula C18H23ClN2O and a molecular weight of 318.85 g/mol. Its IUPAC name is [4-[[2-chloro-5-[2-(1-methylcyclopropyl)ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol.
| Compound Name | [4-[[2-chloro-5-[2-(1-methylcyclopropyl)ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 175857987 |
| Molecular Formula | C18H23ClN2O |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | [4-[[2-chloro-5-[2-(1-methylcyclopropyl)ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol |
| SMILES | CC1(C#Cc2cnc(Cl)cc2NC2CCC(CO)CC2)CC1 |
| InChI | InChI=1S/C18H23ClN2O/c1-18(8-9-18)7-6-14-11-20-17(19)10-16(14)21-15-4-2-13(12-22)3-5-15/h10-11,13,15,22H,2-5,8-9,12H2,1H3,(H,20,21) |
| InChIKey | QLGBMJXFQRNBID-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|