C19H25ClN2O2 — CID 167427097
[4-[[2-chloro-5-[2-[(2S,3S)-2-methyloxolan-3-yl]ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol (PubChem CID 167427097) has the molecular formula C19H25ClN2O2 and a molecular weight of 348.87 g/mol. Its IUPAC name is [4-[[2-chloro-5-[2-[(2S,3S)-2-methyloxolan-3-yl]ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol.
| Compound Name | [4-[[2-chloro-5-[2-[(2S,3S)-2-methyloxolan-3-yl]ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol |
|---|---|
| PubChem CID | 167427097 |
| Molecular Formula | C19H25ClN2O2 |
| Molecular Weight | 348.87 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | [4-[[2-chloro-5-[2-[(2S,3S)-2-methyloxolan-3-yl]ethynyl]-4-pyridinyl]amino]cyclohexyl]methanol |
| SMILES | C[C@@H]1OCC[C@H]1C#Cc1cnc(Cl)cc1NC1CCC(CO)CC1 |
| InChI | InChI=1S/C19H25ClN2O2/c1-13-15(8-9-24-13)4-5-16-11-21-19(20)10-18(16)22-17-6-2-14(12-23)3-7-17/h10-11,13-15,17,23H,2-3,6-9,12H2,1H3,(H,21,22)/t13-,14?,15+,17?/m0/s1 |
| InChIKey | ZHIUVXOTWRLTBX-UJEKJILKSA-N |
| XLogP | 3.47 |
| TPSA | 54.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.87 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|